This website does readability filtering of other pages. All styles, scripts, forms and ads are stripped. If you want your website excluded or have other feedback, use this form.

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 4-Acetoxy-DET: Difference between pages - Wikipedia

Help

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 4-Acetoxy-DET: Difference between pages

(Difference between pages) Jump to navigation Jump to search Revision as of 18:06, 16 February 2012 (edit) Beetstra (talk | contribs) (Saving copy of the {{drugbox}} taken from revid 464118261 of page 4-Acetoxy-DET for the Chem/Drugbox validation project (updated: '').) Latest revision as of 12:02, 22 June 2019 (edit) Edgar181 (talk | contribs) (added Category:Diethylamino compounds using HotCat) Tag: PHP7 Line 1: Line 1: − {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:4-Acetoxy-DET|oldid=464118261}} 464118261] of page [[4-Acetoxy-DET]] with values updated to verified values.}} {{Drugbox {{Drugbox + | Verifiedfields = changed | Watchedfields = changed | Watchedfields = changed − | verifiedrevid = 436414157 + | verifiedrevid = 477220842 | IUPAC_name = 3-(2-Diethylaminoethyl)-1''H''-indol-4-yl acetate | IUPAC_name = 3-(2-Diethylaminoethyl)-1''H''-indol-4-yl acetate | image = 4-Acetoxy-DET.png | image = 4-Acetoxy-DET.png Line 9: Line 9: <!--Clinical data--> <!--Clinical data--> − | tradename = + | tradename = − | pregnancy_AU = + | pregnancy_AU = − | pregnancy_US = + | pregnancy_US = − | pregnancy_category = + | pregnancy_category = − | legal_AU = + | legal_AU = − | legal_CA = + | legal_CA = − | legal_UK = + | legal_UK = − | legal_US = + | legal_US = − | legal_status = + | legal_status = − | routes_of_administration = + | routes_of_administration = <!--Pharmacokinetic data--> <!--Pharmacokinetic data--> − | bioavailability = + | bioavailability = − | protein_bound = + | protein_bound = − | metabolism = + | metabolism = − | elimination_half-life = + | elimination_half-life = − | excretion = + | excretion = <!--Identifiers--> <!--Identifiers--> − | CAS_number_Ref = {{cascite|correct|??}} + | CAS_number_Ref = {{cascite|changed|??}} − | CAS_number = + | CAS_number = 1135424-15-5 − | ATC_prefix = + | ATC_prefix = − | ATC_suffix = + | ATC_suffix = − | PubChem = + | PubChem = | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 21106239 | ChemSpiderID = 21106239 <!--Chemical data--> <!--Chemical data--> − | C=16 | H=22 | N=2 | O=2 + | C=16 | H=22 | N=2 | O=2 − | molecular_weight = 274.36 g/mol + | molecular_weight = 274.36&nbsp;g/mol − | smiles = CC(=O)Oc2cccc1ncc(CCN(CC)CC)c12 + | smiles = CC(OC1=CC=CC2=C1C(CCN(CC)CC)=CN2)=O − | InChI = 1/C16H22N2O2/c1-4-18(5-2)10-9-13-11-17-14-7-6-8-15(16(13)14)20-12(3)19/h6-8,11,17H,4-5,9-10H2,1-3H3 − | InChIKey = WYEVVQJLTXBMPM-UHFFFAOYAX | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C16H22N2O2/c1-4-18(5-2)10-9-13-11-17-14-7-6-8-15(16(13)14)20-12(3)19/h6-8,11,17H,4-5,9-10H2,1-3H3 | StdInChI = 1S/C16H22N2O2/c1-4-18(5-2)10-9-13-11-17-14-7-6-8-15(16(13)14)20-12(3)19/h6-8,11,17H,4-5,9-10H2,1-3H3 − | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} + | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} − | StdInChIKey = WYEVVQJLTXBMPM-UHFFFAOYSA-N + | StdInChIKey = ODVLAYUXIAMBFN-UHFFFAOYSA-N − | melting_point = + | melting_point = − | melting_high = + | melting_high = }} }} + '''4-Acetoxy-DET''' (4-Acetoxy-''N'',''N''-diethyltryptamine), also known as '''ethacetin''', '''ethylacybin''' or '''4-AcO-DET''' is a [[psychedelic drug|psychedelic]] [[tryptamine]]. It was first synthesized in 1958 by [[Albert Hofmann]] in the [[Sandoz]] lab.<ref name="primer">[http://www.erowid.org/chemicals/4_acetoxy_det/4_acetoxy_det_primer.shtml Erowid 4-Acetoxy-DET Vaults : Primer]. Accessed on April 19, 2007.</ref> + + It is expected that the compound is quickly [[hydrolysis|hydrolyzed]] into the free phenolic [[4-HO-DET]] by [[serum esterase]]s, but human studies concerning the metabolic fate of this drug are lacking. + + ==Dosage== + 4-Acetoxy-DET is orally active, and dosages of 10–25&nbsp;mg are common. Effects last 4–6 hours.<ref name="tihkal">''Tikhal: The Chemistry Continues'' by Alexander and Ann Shulgin. [http://www.erowid.org/library/books_online/tihkal/tihkal16.shtml #16. 4-HO-DET]. Accessed on April 19, 2007.</ref> The free [[base (chemistry)|base]] is also active when smoked in a dose range of 5–20&nbsp;mg.<ref name="primer"/> Smoking 4-acetoxy-DET greatly speeds up the onset; [[peak experiences|peak]] effects are experienced within 10 minutes, and are usually over within 1 hour.{{Specify|date=April 2007}} + + ==Drug prohibition laws== + + ===Sweden=== + [[Riksdag|''Sveriges riksdags'']] health ministry [[:sv:Statens folkhälsoinstitut|''Statens folkhälsoinstitut'']] classified 4-AcO-DET as "health hazard" under the act [[:sv:Lagen om förbud mot vissa hälsofarliga varor|''Lagen om förbud mot vissa hälsofarliga varor'']] (translated ''Act on the Prohibition of Certain Goods Dangerous to Health'') as of Nov 1, 2005, in their regulation '''SFS 2005:733''' listed as '''4-acetoxi-N,N-dietyltryptamin (4-AcO-DET)''', making it illegal to sell or possess.<ref name="notisum">{{cite web|url=http://www.notisum.se/rnp/sls/sfs/20050733.pdf|date=13 October 2005| title=Förordning om ändring i förordningen (1999:58) om förbud mot vissa hälsofarliga varor;|author=Svensk författningssamling|accessdate=October 10, 2015}}</ref> + + ==References== + {{reflist}} + + ==External links== + *[http://www.erowid.org/chemicals/4_acetoxy_det/4_acetoxy_det.shtml Erowid 4-Acetoxy-DET vault] + *{{sv icon}} [https://web.archive.org/web/20070927010843/http://www.fhi.se/upload/ar2005/ovrigt/4-AcO-DET.pdf Classification document by the Swedish Institute of Health regarding 4-Acetoxy-DET] + + {{Hallucinogens}} + {{Tryptamines}} + + {{DEFAULTSORT:Acetoxy-Det, 4-}} + [[Category:Acetate esters]] + [[Category:Psychedelic tryptamines]] + [[Category:Designer drugs]] + [[Category:Diethylamino compounds]] Retrieved from "[en.wikipedia.org]"

Navigation menu

Personal tools

Namespaces

Variants

    Views

      More

        Navigation

        Interaction

        Tools

        Languages