This website does readability filtering of other pages. All styles, scripts, forms and ads are stripped. If you want your website excluded or have other feedback, use this form.

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Monosodium citrate: Difference between pages - Wikipedia

Help

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Monosodium citrate: Difference between pages

(Difference between pages) Jump to navigation Jump to search Revision as of 12:47, 24 November 2011 (edit) Beetstra (talk | contribs) (Saving copy of the {{chembox}} taken from revid 456999160 of page Monosodium_citrate for the Chem/Drugbox validation project (updated: '').) Latest revision as of 13:01, 5 June 2020 (edit) Fswitzer4 (talk | contribs) m (Validated CAS) Line 1: Line 1: + {{More citations needed|date=September 2015}} − {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Monosodium_citrate|oldid=456999160}} 456999160] of page [[Monosodium_citrate]] with values updated to verified values.}} {{Chembox {{Chembox + | Verifiedfields = changed − | Name = {{PAGENAME}} + | Watchedfields = changed + | verifiedrevid = 462253460 + | Name = Monosodium citrate | ImageFile = Monosodium citrate.png | ImageFile = Monosodium citrate.png | OtherNames = sodium dihydrogen 2-hydroxypropane-1,2,3-tricarboxylate | OtherNames = sodium dihydrogen 2-hydroxypropane-1,2,3-tricarboxylate | Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers + | PubChem = 23662352 | ChemSpiderID = 5989 + | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChEMBL = 1355 | ChemSpiderID = 27304 + | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = | InChI1 = 1/C6H8O7.3Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;/q;3*+1/p-3 | InChI1 = 1/C6H8O7.3Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;/q;3*+1/p-3 | InChIKey1 = HRXKRNGNAMMEHJ-DFZHHIFOAL | InChIKey1 = HRXKRNGNAMMEHJ-DFZHHIFOAL + | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 53258 | ChEBI = 53258 + | StdInChI_Ref = {{stdinchicite|changed|chemspider}} − | StdInChI = 1S/C6H8O7.3Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;/q;3*+1/p-3 + | StdInChI = 1S/C6H8O7.Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;+1/p-1 | StdInChIKey = HRXKRNGNAMMEHJ-UHFFFAOYSA-K + | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | SMILES = [Na+].[Na+].[Na+].O=C([O-])CC(O)(C([O-])=O)CC(=O)[O-] | StdInChIKey = HWPKGOGLCKPRLZ-UHFFFAOYSA-M | CASNo = | SMILES = C(C(=O)O)C(CC(=O)O)(C(=O)[O-])O.[Na+] + | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 18996-35-5 + | UNII_Ref = {{fdacite|correct|FDA}} + | UNII = 68538UP9SE + | EINECS = 242-734-6 + | RTECS = GE9750000 }} }} | Section2 = {{Chembox Properties | Section2 = {{Chembox Properties | Na = 1 | C = 6 | H = 7 | O = 7 | Na = 1 | C = 6 | H = 7 | O = 7 + | Appearance = white powder <br> [[hygroscopic]] + | Odor = odorless + | MeltingPtC = 212 + | Solubility = soluble + | SolubleOther = negligible in [[ethanol]] + | pKa = 3.50 - 3.80 }} }} }} }} + + '''Monosodium citrate''', more correctly, sodium dihydrogen citrate (Latin: ''natrium citricum acidulatum''), is an [[acid salt]] of [[citric acid]]. [[Disodium citrate]] and [[trisodium citrate]] are also known. It can be prepared by partial neutralisation of an aqueous solution of [[sodium bicarbonate]] or carbonate with citric acid. + + :NaHCO<sub>3</sub> + C<sub>6</sub>H<sub>8</sub>O<sub>7</sub> → NaC<sub>6</sub>H<sub>7</sub>O<sub>7</sub> + CO<sub>2</sub> + H<sub>2</sub>O + + It is highly soluble in water and practically insoluble in ethanol. Monosodium citrate is used as an [[anticoagulant]] in [[blood donation|donated blood]].<ref>[https://books.google.com/books?id=cHAjsUgegpQC&pg=PA20&dq=monosodium+citrate+anticoagulant&hl=en&sa=X&ved=0CCYQ6AEwAGoVChMIq9CT84bNxwIVgYqQCh1H6ASk#v=onepage&q=monosodium%20citrate%20anticoagulant&f=false Clinical Hematology: Theory and Procedures], Mary Louise Turgeon</ref> + + ==References== + {{Reflist}} + + {{DEFAULTSORT:Monosodium Citrate}} + [[Category:Organic sodium salts]] + [[Category:Food additives]] + [[Category:Citrates]] + [[Category:Acid salts]] + [[Category:E-number additives]] + + + {{organic-compound-stub}} Retrieved from "[en.wikipedia.org]"

Navigation menu