This website does readability filtering of other pages. All styles, scripts, forms and ads are stripped. If you want your website excluded or have other feedback, use this form.

Dimethylaminopropionylphenothiazine: Difference between revisions - Wikipedia

Help

Dimethylaminopropionylphenothiazine: Difference between revisions

Jump to navigation Jump to search Browse history interactively Revision as of 18:30, 16 September 2011 (edit) CheMoBot (talk | contribs) (Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation) ← Previous edit Latest revision as of 16:25, 30 November 2015 (edit) (undo) DePiep (talk | contribs) m (Chembox: move all ATCCode-parameters into section Parmacology. See WP:Chembox talk#Drugbank_and_ATC_positioning (+minor param corrections) (via AWB script)) (9 intermediate revisions by 7 users not shown) Line 1: Line 1: + {{multiple issues| + {{context|date=May 2014}} + {{notability|date=May 2014}} + {{unreferenced|date=May 2014}} + }} {{chembox {{chembox + | Verifiedfields = changed | verifiedrevid = 427439120 + | Watchedfields = changed |ImageFile=Astra 1397.png | verifiedrevid = 450846536 |ImageSize=200px | ImageFile = Astra 1397.png |IUPACName=2-(Dimethylamino)-1-phenothiazin-10-ylpropan-1-one | ImageSize = 150 |OtherNames=Astra 1397 + | ImageAlt = Skeletal formula of dimethylaminopropionylphenothiazine + | ImageFile1 = Dimethylaminopropionylphenothiazine 3D spacefill.png + | ImageSize1 = 160 + | ImageAlt1 = Space-filling model of the Dimethylaminopropionylphenothiazine molecule | IUPACName=2-(Dimethylamino)-1-phenothiazin-10-ylpropan-1-one | OtherNames=Astra 1397 |Section1={{Chembox Identifiers |Section1={{Chembox Identifiers + | CASNo_Ref = {{cascite|correct|??}} − | CASNo=63834-04-8 + | CASNo=63834-04-8 | CASOther=<br>[51818-93-0] ([[hydrochloride|HCl]]) + | CASNo2_Ref = {{cascite|changed|??}} | PubChem=113918 + | CASNo2 = 51818-93-0 | SMILES=CC(C(=O)N1C2=CC=CC=C2SC3=CC=CC=C31)N(C)C | CASNo2_Comment =([[hydrochloride|HCl]]) | PubChem=113918 | SMILES=CC(C(=O)N1C2=CC=CC=C2SC3=CC=CC=C31)N(C)C + | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} + | ChemSpiderID = 102089 + | InChI = 1/C17H18N2OS/c1-12(18(2)3)17(20)19-13-8-4-6-10-15(13)21-16-11-7-5-9-14(16)19/h4-12H,1-3H3 + | InChIKey = POZJNEBUHLZROM-UHFFFAOYAG + | StdInChI_Ref = {{stdinchicite|changed|chemspider}} + | StdInChI = 1S/C17H18N2OS/c1-12(18(2)3)17(20)19-13-8-4-6-10-15(13)21-16-11-7-5-9-14(16)19/h4-12H,1-3H3 + | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} + | StdInChIKey = POZJNEBUHLZROM-UHFFFAOYSA-N }} }} |Section2={{Chembox Properties |Section2={{Chembox Properties − | Formula=C<sub>17</sub>H<sub>18</sub>N<sub>2</sub>OS + | Formula=C<sub>17</sub>H<sub>18</sub>N<sub>2</sub>OS − | MolarMass=298.40 g/mol + | MolarMass=298.40 g/mol − | Appearance= + | Appearance= − | Density= + | Density= − | MeltingPt= + | MeltingPt= − | BoilingPt= + | BoilingPt= − | Solubility= + | Solubility= }} }} − |Section3={{Chembox Hazards + |Section6={{Chembox Pharmacology + | ATCCode_prefix = A03 | MainHazards= + | ATCCode_suffix = AC02 | FlashPt= + }} − | Autoignition= + |Section7={{Chembox Hazards | MainHazards= | FlashPt= + | AutoignitionPt= }} }} }} }} Line 30: Line 56: + {{Drugs for functional gastrointestinal disorders}} [[Category:Phenothiazines]] [[Category:Phenothiazines]] Retrieved from "[en.wikipedia.org]"

Navigation menu

Personal tools

Namespaces

Variants

    Views

      More

        Navigation

        Interaction

        Tools

        Languages